C10H9BrF3N3O4 — CID 103370508
2-[(2-bromo-3-nitrophenoxy)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103370508) has the molecular formula C10H9BrF3N3O4 and a molecular weight of 372.10 g/mol. Its IUPAC name is 2-[(2-bromo-3-nitrophenoxy)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[(2-bromo-3-nitrophenoxy)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103370508 |
| Molecular Formula | C10H9BrF3N3O4 |
| Molecular Weight | 372.10 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 2-[(2-bromo-3-nitrophenoxy)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | N/C(=N/O)C(COc1cccc([N+](=O)[O-])c1Br)C(F)(F)F |
| InChI | InChI=1S/C10H9BrF3N3O4/c11-8-6(17(19)20)2-1-3-7(8)21-4-5(9(15)16-18)10(12,13)14/h1-3,5,18H,4H2,(H2,15,16) |
| InChIKey | MHCNVNCNJNFRMI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.10 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|