C29H35N3O4S — CID 139753750
tert-butyl N-[(2S)-2-hydroxy-3-phenoxypropyl]-N-[2-[4-(phenylcarbamothioylamino)phenyl]ethyl]carbamate (PubChem CID 139753750) has the molecular formula C29H35N3O4S and a molecular weight of 521.68 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-hydroxy-3-phenoxypropyl]-N-[2-[4-(phenylcarbamothioylamino)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-hydroxy-3-phenoxypropyl]-N-[2-[4-(phenylcarbamothioylamino)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 139753750 |
| Molecular Formula | C29H35N3O4S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | tert-butyl N-[(2S)-2-hydroxy-3-phenoxypropyl]-N-[2-[4-(phenylcarbamothioylamino)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccc(NC(=S)Nc2ccccc2)cc1)C[C@H](O)COc1ccccc1 |
| InChI | InChI=1S/C29H35N3O4S/c1-29(2,3)36-28(34)32(20-25(33)21-35-26-12-8-5-9-13-26)19-18-22-14-16-24(17-15-22)31-27(37)30-23-10-6-4-7-11-23/h4-17,25,33H,18-21H2,1-3H3,(H2,30,31,37)/t25-/m0/s1 |
| InChIKey | NPKHYHJWLMCUJQ-VWLOTQADSA-N |
| XLogP | 5.72 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|