C34H36N2O4 — CID 45280824
tert-butyl N-[[4-[(3-benzamidophenyl)methoxy]phenyl]methyl]-N-(2-phenylethyl)carbamate (PubChem CID 45280824) has the molecular formula C34H36N2O4 and a molecular weight of 536.67 g/mol. Its IUPAC name is tert-butyl N-[[4-[(3-benzamidophenyl)methoxy]phenyl]methyl]-N-(2-phenylethyl)carbamate.
| Compound Name | tert-butyl N-[[4-[(3-benzamidophenyl)methoxy]phenyl]methyl]-N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 45280824 |
| Molecular Formula | C34H36N2O4 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | tert-butyl N-[[4-[(3-benzamidophenyl)methoxy]phenyl]methyl]-N-(2-phenylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccccc1)Cc1ccc(OCc2cccc(NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C34H36N2O4/c1-34(2,3)40-33(38)36(22-21-26-11-6-4-7-12-26)24-27-17-19-31(20-18-27)39-25-28-13-10-16-30(23-28)35-32(37)29-14-8-5-9-15-29/h4-20,23H,21-22,24-25H2,1-3H3,(H,35,37) |
| InChIKey | FJTQTCXWMJMOKE-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |