C26H29NO3S — CID 91503226
tert-butyl N-benzyl-N-[2-[4-(3-hydroxyphenyl)sulfanylphenyl]ethyl]carbamate (PubChem CID 91503226) has the molecular formula C26H29NO3S and a molecular weight of 435.59 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[2-[4-(3-hydroxyphenyl)sulfanylphenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[2-[4-(3-hydroxyphenyl)sulfanylphenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 91503226 |
| Molecular Formula | C26H29NO3S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | tert-butyl N-benzyl-N-[2-[4-(3-hydroxyphenyl)sulfanylphenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccc(Sc2cccc(O)c2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H29NO3S/c1-26(2,3)30-25(29)27(19-21-8-5-4-6-9-21)17-16-20-12-14-23(15-13-20)31-24-11-7-10-22(28)18-24/h4-15,18,28H,16-17,19H2,1-3H3 |
| InChIKey | WSLWRZYHNSCELA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |