C25H40NO3P — CID 142297237
tert-butyl N-(2-hydroxy-3-phenylpropyl)-N-propylcarbamate;ethane;phenylphosphane (PubChem CID 142297237) has the molecular formula C25H40NO3P and a molecular weight of 433.57 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxy-3-phenylpropyl)-N-propylcarbamate;ethane;phenylphosphane.
| Compound Name | tert-butyl N-(2-hydroxy-3-phenylpropyl)-N-propylcarbamate;ethane;phenylphosphane |
|---|---|
| PubChem CID | 142297237 |
| Molecular Formula | C25H40NO3P |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | tert-butyl N-(2-hydroxy-3-phenylpropyl)-N-propylcarbamate;ethane;phenylphosphane |
| SMILES | CC.CCCN(CC(O)Cc1ccccc1)C(=O)OC(C)(C)C.Pc1ccccc1 |
| InChI | InChI=1S/C17H27NO3.C6H7P.C2H6/c1-5-11-18(16(20)21-17(2,3)4)13-15(19)12-14-9-7-6-8-10-14;7-6-4-2-1-3-5-6;1-2/h6-10,15,19H,5,11-13H2,1-4H3;1-5H,7H2;1-2H3 |
| InChIKey | YXVHPPLDDMDCCU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|