C19H15FO3S — CID 139755225
3-[2-[(7-fluoro-4-oxothiochromen-3-yl)methyl]phenyl]propanoic acid (PubChem CID 139755225) has the molecular formula C19H15FO3S and a molecular weight of 342.39 g/mol. Its IUPAC name is 3-[2-[(7-fluoro-4-oxothiochromen-3-yl)methyl]phenyl]propanoic acid.
| Compound Name | 3-[2-[(7-fluoro-4-oxothiochromen-3-yl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139755225 |
| Molecular Formula | C19H15FO3S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 3-[2-[(7-fluoro-4-oxothiochromen-3-yl)methyl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccccc1Cc1csc2cc(F)ccc2c1=O |
| InChI | InChI=1S/C19H15FO3S/c20-15-6-7-16-17(10-15)24-11-14(19(16)23)9-13-4-2-1-3-12(13)5-8-18(21)22/h1-4,6-7,10-11H,5,8-9H2,(H,21,22) |
| InChIKey | JVHXDZAWTADPMJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |