C23H19ClN2O5 — CID 139755893
2-(1,3-benzodioxol-5-yloxy)-4-[2-(3-chloropropoxy)-4-methoxyphenyl]pyridine-3-carbonitrile (PubChem CID 139755893) has the molecular formula C23H19ClN2O5 and a molecular weight of 438.87 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-4-[2-(3-chloropropoxy)-4-methoxyphenyl]pyridine-3-carbonitrile.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-4-[2-(3-chloropropoxy)-4-methoxyphenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 139755893 |
| Molecular Formula | C23H19ClN2O5 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-4-[2-(3-chloropropoxy)-4-methoxyphenyl]pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2ccnc(Oc3ccc4c(c3)OCO4)c2C#N)c(OCCCCl)c1 |
| InChI | InChI=1S/C23H19ClN2O5/c1-27-15-3-5-18(21(11-15)28-10-2-8-24)17-7-9-26-23(19(17)13-25)31-16-4-6-20-22(12-16)30-14-29-20/h3-7,9,11-12H,2,8,10,14H2,1H3 |
| InChIKey | FQVDIZNVVURDPE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 82.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|