C13H18F3NO4S — CID 139756470
[3-methoxy-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol (PubChem CID 139756470) has the molecular formula C13H18F3NO4S and a molecular weight of 341.35 g/mol. Its IUPAC name is [3-methoxy-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol.
| Compound Name | [3-methoxy-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 139756470 |
| Molecular Formula | C13H18F3NO4S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [3-methoxy-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
| SMILES | COc1c(SCCOCCOCC(F)(F)F)ccnc1CO |
| InChI | InChI=1S/C13H18F3NO4S/c1-19-12-10(8-18)17-3-2-11(12)22-7-6-20-4-5-21-9-13(14,15)16/h2-3,18H,4-9H2,1H3 |
| InChIKey | FORZUEBSFKTJGK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|