C13H18F3NO4S — CID 139756505
3-methoxy-2-methyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium (PubChem CID 139756505) has the molecular formula C13H18F3NO4S and a molecular weight of 341.35 g/mol. Its IUPAC name is 3-methoxy-2-methyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium.
| Compound Name | 3-methoxy-2-methyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium |
|---|---|
| PubChem CID | 139756505 |
| Molecular Formula | C13H18F3NO4S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 3-methoxy-2-methyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium |
| SMILES | COc1c(SCCOCCOCC(F)(F)F)cc[n+]([O-])c1C |
| InChI | InChI=1S/C13H18F3NO4S/c1-10-12(19-2)11(3-4-17(10)18)22-8-7-20-5-6-21-9-13(14,15)16/h3-4H,5-9H2,1-2H3 |
| InChIKey | TXVRAJJUCWHMHH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|