C11H14F3NO3S — CID 141058414
3-methoxy-2-methylsulfanyl-4-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine (PubChem CID 141058414) has the molecular formula C11H14F3NO3S and a molecular weight of 297.30 g/mol. Its IUPAC name is 3-methoxy-2-methylsulfanyl-4-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine.
| Compound Name | 3-methoxy-2-methylsulfanyl-4-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine |
|---|---|
| PubChem CID | 141058414 |
| Molecular Formula | C11H14F3NO3S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-methoxy-2-methylsulfanyl-4-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine |
| SMILES | COc1c(OCCOCC(F)(F)F)ccnc1SC |
| InChI | InChI=1S/C11H14F3NO3S/c1-16-9-8(3-4-15-10(9)19-2)18-6-5-17-7-11(12,13)14/h3-4H,5-7H2,1-2H3 |
| InChIKey | AOLZCFHJDZHPBZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|