C22H24N2O3 — CID 139757413
tert-butyl (2S)-4-benzyl-3-oxo-2-phenyl-2H-pyrazine-1-carboxylate (PubChem CID 139757413) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is tert-butyl (2S)-4-benzyl-3-oxo-2-phenyl-2H-pyrazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-benzyl-3-oxo-2-phenyl-2H-pyrazine-1-carboxylate |
|---|---|
| PubChem CID | 139757413 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | tert-butyl (2S)-4-benzyl-3-oxo-2-phenyl-2H-pyrazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CN(Cc2ccccc2)C(=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3/c1-22(2,3)27-21(26)24-15-14-23(16-17-10-6-4-7-11-17)20(25)19(24)18-12-8-5-9-13-18/h4-15,19H,16H2,1-3H3/t19-/m0/s1 |
| InChIKey | FXUZTWQDEKPYBS-IBGZPJMESA-N |
| XLogP | 4.48 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |