C17H19ClN6O5S3 — CID 139758039
(6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2-oxopyrrolidin-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid;hydrochloride (PubChem CID 139758039) has the molecular formula C17H19ClN6O5S3 and a molecular weight of 519.03 g/mol. Its IUPAC name is (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2-oxopyrrolidin-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid;hydrochloride.
| Compound Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2-oxopyrrolidin-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid;hydrochloride |
|---|---|
| PubChem CID | 139758039 |
| Molecular Formula | C17H19ClN6O5S3 |
| Molecular Weight | 519.03 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2-oxopyrrolidin-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid;hydrochloride |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)S)=C(C3CCNC3=O)CS[C@H]12)c1csc(N)n1.Cl |
| InChI | InChI=1S/C17H18N6O5S3.ClH/c1-28-22-9(8-5-31-17(18)20-8)13(25)21-10-14(26)23-11(16(27)29)7(4-30-15(10)23)6-2-3-19-12(6)24;/h5-6,10,15H,2-4H2,1H3,(H2,18,20)(H,19,24)(H,21,25)(H,27,29);1H/t6?,10-,15-;/m1./s1 |
| InChIKey | UQYBREGSURDNIU-YGTICTKUSA-N |
| XLogP | -0.26 |
| TPSA | 156.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.03 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|