C15H13N7O4S4 — CID 139780333
(6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid (PubChem CID 139780333) has the molecular formula C15H13N7O4S4 and a molecular weight of 483.58 g/mol. Its IUPAC name is (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid.
| Compound Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
|---|---|
| PubChem CID | 139780333 |
| Molecular Formula | C15H13N7O4S4 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)S)=C(c3nncs3)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C15H13N7O4S4/c1-26-21-7(6-3-29-15(16)18-6)10(23)19-8-12(24)22-9(14(25)27)5(2-28-13(8)22)11-20-17-4-30-11/h3-4,8,13H,2H2,1H3,(H2,16,18)(H,19,23)(H,25,27)/t8-,13-/m1/s1 |
| InChIKey | VPOCOGJDZIKPLC-AMIZOPFISA-N |
| XLogP | 0.19 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|