C18H15N9O4S3 — CID 139650250
(6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid (PubChem CID 139650250) has the molecular formula C18H15N9O4S3 and a molecular weight of 517.58 g/mol. Its IUPAC name is (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid.
| Compound Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
|---|---|
| PubChem CID | 139650250 |
| Molecular Formula | C18H15N9O4S3 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,2,4]triazolo[1,5-a]pyrimidin-5-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)S)=C(c3ccn4ncnc4n3)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C18H15N9O4S3/c1-31-25-10(9-5-34-17(19)22-9)13(28)24-11-14(29)27-12(16(30)32)7(4-33-15(11)27)8-2-3-26-18(23-8)20-6-21-26/h2-3,5-6,11,15H,4H2,1H3,(H2,19,22)(H,24,28)(H,30,32)/t11-,15-/m1/s1 |
| InChIKey | LMCFKWKHMHLJMF-IAQYHMDHSA-N |
| XLogP | -0.22 |
| TPSA | 170.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|