C16H28O13 — CID 139759910
(3R,4R)-1,3,4,5-tetrahydroxy-1-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]pentan-2-one (PubChem CID 139759910) has the molecular formula C16H28O13 and a molecular weight of 428.39 g/mol. Its IUPAC name is (3R,4R)-1,3,4,5-tetrahydroxy-1-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]pentan-2-one.
| Compound Name | (3R,4R)-1,3,4,5-tetrahydroxy-1-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]pentan-2-one |
|---|---|
| PubChem CID | 139759910 |
| Molecular Formula | C16H28O13 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (3R,4R)-1,3,4,5-tetrahydroxy-1-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]pentan-2-one |
| SMILES | C[C@@H]1OC(C(O)(C(=O)[C@H](O)[C@H](O)CO)C2OC[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H28O13/c1-4-7(20)10(23)12(25)15(29-4)16(27,13(26)9(22)5(18)2-17)14-11(24)8(21)6(19)3-28-14/h4-12,14-15,17-25,27H,2-3H2,1H3/t4-,5+,6+,7-,8-,9+,10+,11+,12+,14?,15?,16?/m0/s1 |
| InChIKey | SFGBKULPRVUFJZ-CYMJVYGZSA-N |
| XLogP | -6.65 |
| TPSA | 237.83 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | -6.65 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |