C17H16ClNO3S — CID 139762809
benzyl 5-[5-(chloromethyl)thiophen-2-yl]-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 139762809) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is benzyl 5-[5-(chloromethyl)thiophen-2-yl]-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
| Compound Name | benzyl 5-[5-(chloromethyl)thiophen-2-yl]-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 139762809 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | benzyl 5-[5-(chloromethyl)thiophen-2-yl]-2-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | CC1=NC(C(=O)OCc2ccccc2)C(c2ccc(CCl)s2)O1 |
| InChI | InChI=1S/C17H16ClNO3S/c1-11-19-15(16(22-11)14-8-7-13(9-18)23-14)17(20)21-10-12-5-3-2-4-6-12/h2-8,15-16H,9-10H2,1H3 |
| InChIKey | CGOYXOOJSQVCNQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|