C21H34O — CID 139763370
(E)-1-(3-hex-1-ynyl-2-bicyclo[2.2.1]heptanyl)oct-1-en-3-ol (PubChem CID 139763370) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is (E)-1-(3-hex-1-ynyl-2-bicyclo[2.2.1]heptanyl)oct-1-en-3-ol.
| Compound Name | (E)-1-(3-hex-1-ynyl-2-bicyclo[2.2.1]heptanyl)oct-1-en-3-ol |
|---|---|
| PubChem CID | 139763370 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (E)-1-(3-hex-1-ynyl-2-bicyclo[2.2.1]heptanyl)oct-1-en-3-ol |
| SMILES | CCCCC#CC1C2CCC(C2)C1/C=C/C(O)CCCCC |
| InChI | InChI=1S/C21H34O/c1-3-5-7-9-11-20-17-12-13-18(16-17)21(20)15-14-19(22)10-8-6-4-2/h14-15,17-22H,3-8,10,12-13,16H2,1-2H3/b15-14+ |
| InChIKey | ZFDFXDDXJSPTBR-CCEZHUSRSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|