C27H46O4Si — CID 11005078
methyl 2-[3-[(1S,2R,3R,4R)-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-bicyclo[2.2.1]heptanyl]prop-2-ynoxy]acetate (PubChem CID 11005078) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is methyl 2-[3-[(1S,2R,3R,4R)-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-bicyclo[2.2.1]heptanyl]prop-2-ynoxy]acetate.
| Compound Name | methyl 2-[3-[(1S,2R,3R,4R)-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-bicyclo[2.2.1]heptanyl]prop-2-ynoxy]acetate |
|---|---|
| PubChem CID | 11005078 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | methyl 2-[3-[(1S,2R,3R,4R)-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-bicyclo[2.2.1]heptanyl]prop-2-ynoxy]acetate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H]2CC[C@@H](C2)[C@H]1C#CCOCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46O4Si/c1-8-9-10-12-23(31-32(6,7)27(2,3)4)16-17-25-22-15-14-21(19-22)24(25)13-11-18-30-20-26(28)29-5/h16-17,21-25H,8-10,12,14-15,18-20H2,1-7H3/b17-16+/t21-,22+,23-,24+,25-/m0/s1 |
| InChIKey | IKRNYGSXXCRNQZ-AKCRQTNLSA-N |
| XLogP | 6.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|