C20H20ClNO4S — CID 139763676
3-(4-chloro-2-nitrobenzoyl)-4-(3-methylbut-3-enylsulfanyl)bicyclo[3.2.1]oct-3-en-2-one (PubChem CID 139763676) has the molecular formula C20H20ClNO4S and a molecular weight of 405.90 g/mol. Its IUPAC name is 3-(4-chloro-2-nitrobenzoyl)-4-(3-methylbut-3-enylsulfanyl)bicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | 3-(4-chloro-2-nitrobenzoyl)-4-(3-methylbut-3-enylsulfanyl)bicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 139763676 |
| Molecular Formula | C20H20ClNO4S |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 3-(4-chloro-2-nitrobenzoyl)-4-(3-methylbut-3-enylsulfanyl)bicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C=C(C)CCSC1=C(C(=O)c2ccc(Cl)cc2[N+](=O)[O-])C(=O)C2CCC1C2 |
| InChI | InChI=1S/C20H20ClNO4S/c1-11(2)7-8-27-20-13-4-3-12(9-13)18(23)17(20)19(24)15-6-5-14(21)10-16(15)22(25)26/h5-6,10,12-13H,1,3-4,7-9H2,2H3 |
| InChIKey | IYMPUEBRTZRGTH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|