C19H16F3NO4S — CID 139763674
3-[2-nitro-4-(trifluoromethyl)benzoyl]-4-prop-2-enylsulfanylbicyclo[3.2.1]oct-3-en-2-one (PubChem CID 139763674) has the molecular formula C19H16F3NO4S and a molecular weight of 411.40 g/mol. Its IUPAC name is 3-[2-nitro-4-(trifluoromethyl)benzoyl]-4-prop-2-enylsulfanylbicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | 3-[2-nitro-4-(trifluoromethyl)benzoyl]-4-prop-2-enylsulfanylbicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 139763674 |
| Molecular Formula | C19H16F3NO4S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 3-[2-nitro-4-(trifluoromethyl)benzoyl]-4-prop-2-enylsulfanylbicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C=CCSC1=C(C(=O)c2ccc(C(F)(F)F)cc2[N+](=O)[O-])C(=O)C2CCC1C2 |
| InChI | InChI=1S/C19H16F3NO4S/c1-2-7-28-18-11-4-3-10(8-11)16(24)15(18)17(25)13-6-5-12(19(20,21)22)9-14(13)23(26)27/h2,5-6,9-11H,1,3-4,7-8H2 |
| InChIKey | YYJDWGYABZIGGV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|