C35H40O4 — CID 139764904
4-[2-butan-2-yl-4-[2-[3-butan-2-yl-4-(4-hydroxyphenoxy)phenyl]propan-2-yl]phenoxy]phenol (PubChem CID 139764904) has the molecular formula C35H40O4 and a molecular weight of 524.70 g/mol. Its IUPAC name is 4-[2-butan-2-yl-4-[2-[3-butan-2-yl-4-(4-hydroxyphenoxy)phenyl]propan-2-yl]phenoxy]phenol.
| Compound Name | 4-[2-butan-2-yl-4-[2-[3-butan-2-yl-4-(4-hydroxyphenoxy)phenyl]propan-2-yl]phenoxy]phenol |
|---|---|
| PubChem CID | 139764904 |
| Molecular Formula | C35H40O4 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 4-[2-butan-2-yl-4-[2-[3-butan-2-yl-4-(4-hydroxyphenoxy)phenyl]propan-2-yl]phenoxy]phenol |
| SMILES | CCC(C)c1cc(C(C)(C)c2ccc(Oc3ccc(O)cc3)c(C(C)CC)c2)ccc1Oc1ccc(O)cc1 |
| InChI | InChI=1S/C35H40O4/c1-7-23(3)31-21-25(9-19-33(31)38-29-15-11-27(36)12-16-29)35(5,6)26-10-20-34(32(22-26)24(4)8-2)39-30-17-13-28(37)14-18-30/h9-24,36-37H,7-8H2,1-6H3 |
| InChIKey | LJUDGMPFGADGJN-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |