C27H32F8O2 — CID 101009408
2-butan-2-yl-4-[2-[3-butan-2-yl-4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]-1-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 101009408) has the molecular formula C27H32F8O2 and a molecular weight of 540.54 g/mol. Its IUPAC name is 2-butan-2-yl-4-[2-[3-butan-2-yl-4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]-1-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 2-butan-2-yl-4-[2-[3-butan-2-yl-4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]-1-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 101009408 |
| Molecular Formula | C27H32F8O2 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 2-butan-2-yl-4-[2-[3-butan-2-yl-4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]-1-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | CCC(C)c1cc(C(C)(C)c2ccc(OC(F)(F)C(F)F)c(C(C)CC)c2)ccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C27H32F8O2/c1-7-15(3)19-13-17(9-11-21(19)36-26(32,33)23(28)29)25(5,6)18-10-12-22(20(14-18)16(4)8-2)37-27(34,35)24(30)31/h9-16,23-24H,7-8H2,1-6H3 |
| InChIKey | XWYBEIBXELVFGE-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|