C29H44S2 — CID 155694441
1-[2-tert-butyl-5-[2-[4-tert-butyl-3-(1-sulfanylpropyl)phenyl]propan-2-yl]phenyl]propane-1-thiol (PubChem CID 155694441) has the molecular formula C29H44S2 and a molecular weight of 456.81 g/mol. Its IUPAC name is 1-[2-tert-butyl-5-[2-[4-tert-butyl-3-(1-sulfanylpropyl)phenyl]propan-2-yl]phenyl]propane-1-thiol.
| Compound Name | 1-[2-tert-butyl-5-[2-[4-tert-butyl-3-(1-sulfanylpropyl)phenyl]propan-2-yl]phenyl]propane-1-thiol |
|---|---|
| PubChem CID | 155694441 |
| Molecular Formula | C29H44S2 |
| Molecular Weight | 456.81 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 1-[2-tert-butyl-5-[2-[4-tert-butyl-3-(1-sulfanylpropyl)phenyl]propan-2-yl]phenyl]propane-1-thiol |
| SMILES | CCC(S)c1cc(C(C)(C)c2ccc(C(C)(C)C)c(C(S)CC)c2)ccc1C(C)(C)C |
| InChI | InChI=1S/C29H44S2/c1-11-25(30)21-17-19(13-15-23(21)27(3,4)5)29(9,10)20-14-16-24(28(6,7)8)22(18-20)26(31)12-2/h13-18,25-26,30-31H,11-12H2,1-10H3 |
| InChIKey | FXVPCQRUSAGNNB-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.81 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|