About 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid
2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 139765745) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid.
Analyze 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid (CID 139765745) is 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid is C=C1C(OC)=CC=CC1CC(=O)O.
What is the InChIKey of 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is GKZISYQIQIWDOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-7-8(6-10(11)12)4-3-5-9(7)13-2/h3-5,8H,1,6H2,2H3,(H,11,12).
What are the key properties of 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 180.20 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 139765745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).