C34H37N3O7 — CID 139766716
ethyl (E)-3-[2-butyl-3-[4-(pyridin-2-ylmethoxymethoxy)phenyl]imidazol-4-yl]-2-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]prop-2-enoate (PubChem CID 139766716) has the molecular formula C34H37N3O7 and a molecular weight of 599.68 g/mol. Its IUPAC name is ethyl (E)-3-[2-butyl-3-[4-(pyridin-2-ylmethoxymethoxy)phenyl]imidazol-4-yl]-2-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-butyl-3-[4-(pyridin-2-ylmethoxymethoxy)phenyl]imidazol-4-yl]-2-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 139766716 |
| Molecular Formula | C34H37N3O7 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | ethyl (E)-3-[2-butyl-3-[4-(pyridin-2-ylmethoxymethoxy)phenyl]imidazol-4-yl]-2-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]prop-2-enoate |
| SMILES | CCCCc1ncc(/C=C(\Cc2cc3c(cc2OC)OCO3)C(=O)OCC)n1-c1ccc(OCOCc2ccccn2)cc1 |
| InChI | InChI=1S/C34H37N3O7/c1-4-6-10-33-36-20-28(37(33)27-11-13-29(14-12-27)42-22-40-21-26-9-7-8-15-35-26)17-25(34(38)41-5-2)16-24-18-31-32(44-23-43-31)19-30(24)39-3/h7-9,11-15,17-20H,4-6,10,16,21-23H2,1-3H3/b25-17+ |
| InChIKey | DADLSEITXBSERG-KOEQRZSOSA-N |
| XLogP | 6.09 |
| TPSA | 103.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|