C29H33N3O8 — CID 91549181
3-[2-butyl-3-[2-[[formyl(methyl)amino]methoxy]-4-methoxyphenyl]imidazol-4-yl]-2-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]prop-2-enoic acid (PubChem CID 91549181) has the molecular formula C29H33N3O8 and a molecular weight of 551.60 g/mol. Its IUPAC name is 3-[2-butyl-3-[2-[[formyl(methyl)amino]methoxy]-4-methoxyphenyl]imidazol-4-yl]-2-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]prop-2-enoic acid.
| Compound Name | 3-[2-butyl-3-[2-[[formyl(methyl)amino]methoxy]-4-methoxyphenyl]imidazol-4-yl]-2-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91549181 |
| Molecular Formula | C29H33N3O8 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | 3-[2-butyl-3-[2-[[formyl(methyl)amino]methoxy]-4-methoxyphenyl]imidazol-4-yl]-2-[(6-methoxy-1,3-benzodioxol-5-yl)methyl]prop-2-enoic acid |
| SMILES | CCCCc1ncc(C=C(Cc2cc3c(cc2OC)OCO3)C(=O)O)n1-c1ccc(OC)cc1OCN(C)C=O |
| InChI | InChI=1S/C29H33N3O8/c1-5-6-7-28-30-15-21(32(28)23-9-8-22(36-3)13-25(23)38-17-31(2)16-33)11-20(29(34)35)10-19-12-26-27(40-18-39-26)14-24(19)37-4/h8-9,11-16H,5-7,10,17-18H2,1-4H3,(H,34,35) |
| InChIKey | IUFOYNMNWLVNMB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|