C29H28O9 — CID 20638129
(E)-2-(1,3-benzodioxol-5-ylmethyl)-3-[2-[2-(carboxymethoxy)-4-methoxyphenyl]-3-propoxyphenyl]prop-2-enoic acid (PubChem CID 20638129) has the molecular formula C29H28O9 and a molecular weight of 520.53 g/mol. Its IUPAC name is (E)-2-(1,3-benzodioxol-5-ylmethyl)-3-[2-[2-(carboxymethoxy)-4-methoxyphenyl]-3-propoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-2-(1,3-benzodioxol-5-ylmethyl)-3-[2-[2-(carboxymethoxy)-4-methoxyphenyl]-3-propoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20638129 |
| Molecular Formula | C29H28O9 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (E)-2-(1,3-benzodioxol-5-ylmethyl)-3-[2-[2-(carboxymethoxy)-4-methoxyphenyl]-3-propoxyphenyl]prop-2-enoic acid |
| SMILES | CCCOc1cccc(/C=C(\Cc2ccc3c(c2)OCO3)C(=O)O)c1-c1ccc(OC)cc1OCC(=O)O |
| InChI | InChI=1S/C29H28O9/c1-3-11-35-24-6-4-5-19(28(24)22-9-8-21(34-2)15-25(22)36-16-27(30)31)14-20(29(32)33)12-18-7-10-23-26(13-18)38-17-37-23/h4-10,13-15H,3,11-12,16-17H2,1-2H3,(H,30,31)(H,32,33)/b20-14+ |
| InChIKey | ADMIFOASDQSJHY-XSFVSMFZSA-N |
| XLogP | 5.05 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|