C28H26O8 — CID 67644215
1-(1,3-benzodioxol-5-yl)-4-(2-methoxyphenyl)-5-propoxy-1,3-dihydroindene-2,2-dicarboxylic acid (PubChem CID 67644215) has the molecular formula C28H26O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-(2-methoxyphenyl)-5-propoxy-1,3-dihydroindene-2,2-dicarboxylic acid.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-(2-methoxyphenyl)-5-propoxy-1,3-dihydroindene-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67644215 |
| Molecular Formula | C28H26O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-(2-methoxyphenyl)-5-propoxy-1,3-dihydroindene-2,2-dicarboxylic acid |
| SMILES | CCCOc1ccc2c(c1-c1ccccc1OC)CC(C(=O)O)(C(=O)O)C2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H26O8/c1-3-12-34-22-11-9-17-19(24(22)18-6-4-5-7-20(18)33-2)14-28(26(29)30,27(31)32)25(17)16-8-10-21-23(13-16)36-15-35-21/h4-11,13,25H,3,12,14-15H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | VCDZJJSRHCNWTA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|