C24H16Cl4O5 — CID 20583559
(Z)-2-(1,3-benzodioxol-5-ylmethyl)-3-[3,5-dichloro-4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 20583559) has the molecular formula C24H16Cl4O5 and a molecular weight of 526.20 g/mol. Its IUPAC name is (Z)-2-(1,3-benzodioxol-5-ylmethyl)-3-[3,5-dichloro-4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-(1,3-benzodioxol-5-ylmethyl)-3-[3,5-dichloro-4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20583559 |
| Molecular Formula | C24H16Cl4O5 |
| Molecular Weight | 526.20 g/mol |
| Exact Mass | 523.98 |
| IUPAC Name | (Z)-2-(1,3-benzodioxol-5-ylmethyl)-3-[3,5-dichloro-4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1cc(Cl)c(OCc2c(Cl)cccc2Cl)c(Cl)c1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H16Cl4O5/c25-17-2-1-3-18(26)16(17)11-31-23-19(27)8-14(9-20(23)28)7-15(24(29)30)6-13-4-5-21-22(10-13)33-12-32-21/h1-5,7-10H,6,11-12H2,(H,29,30)/b15-7- |
| InChIKey | CJIVMGGXPWNQAK-CHHVJCJISA-N |
| XLogP | 7.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.20 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|