C19H20N4O3 — CID 139767738
methyl N-[2-[[(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-4-methylphenyl]carbamate (PubChem CID 139767738) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl N-[2-[[(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-4-methylphenyl]carbamate.
| Compound Name | methyl N-[2-[[(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 139767738 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | methyl N-[2-[[(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-4-methylphenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(C)cc1CNc1cccn2c(C=O)c(C)nc12 |
| InChI | InChI=1S/C19H20N4O3/c1-12-6-7-15(22-19(25)26-3)14(9-12)10-20-16-5-4-8-23-17(11-24)13(2)21-18(16)23/h4-9,11,20H,10H2,1-3H3,(H,22,25) |
| InChIKey | LRCIZJIXZMFVKC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|