C18H17FN4O3 — CID 139767752
methyl N-[3-fluoro-2-[[(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]carbamate (PubChem CID 139767752) has the molecular formula C18H17FN4O3 and a molecular weight of 356.36 g/mol. Its IUPAC name is methyl N-[3-fluoro-2-[[(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[3-fluoro-2-[[(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 139767752 |
| Molecular Formula | C18H17FN4O3 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | methyl N-[3-fluoro-2-[[(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(F)c1CNc1cccn2c(C=O)c(C)nc12 |
| InChI | InChI=1S/C18H17FN4O3/c1-11-16(10-24)23-8-4-7-15(17(23)21-11)20-9-12-13(19)5-3-6-14(12)22-18(25)26-2/h3-8,10,20H,9H2,1-2H3,(H,22,25) |
| InChIKey | LIQJMEKHTZSSQY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|