C20H35NO3 — CID 139768826
2-tert-butyl-4-[2-hydroxy-5-(4-hydroxybutylamino)pentyl]-5-methylphenol (PubChem CID 139768826) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is 2-tert-butyl-4-[2-hydroxy-5-(4-hydroxybutylamino)pentyl]-5-methylphenol.
| Compound Name | 2-tert-butyl-4-[2-hydroxy-5-(4-hydroxybutylamino)pentyl]-5-methylphenol |
|---|---|
| PubChem CID | 139768826 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 2-tert-butyl-4-[2-hydroxy-5-(4-hydroxybutylamino)pentyl]-5-methylphenol |
| SMILES | Cc1cc(O)c(C(C)(C)C)cc1CC(O)CCCNCCCCO |
| InChI | InChI=1S/C20H35NO3/c1-15-12-19(24)18(20(2,3)4)14-16(15)13-17(23)8-7-10-21-9-5-6-11-22/h12,14,17,21-24H,5-11,13H2,1-4H3 |
| InChIKey | IPZYEKHNWXGXKE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|