C23H40OS — CID 139881073
2-tert-butyl-5-methyl-4-(9-sulfanyldodecyl)phenol (PubChem CID 139881073) has the molecular formula C23H40OS and a molecular weight of 364.64 g/mol. Its IUPAC name is 2-tert-butyl-5-methyl-4-(9-sulfanyldodecyl)phenol.
| Compound Name | 2-tert-butyl-5-methyl-4-(9-sulfanyldodecyl)phenol |
|---|---|
| PubChem CID | 139881073 |
| Molecular Formula | C23H40OS |
| Molecular Weight | 364.64 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 2-tert-butyl-5-methyl-4-(9-sulfanyldodecyl)phenol |
| SMILES | CCCC(S)CCCCCCCCc1cc(C(C)(C)C)c(O)cc1C |
| InChI | InChI=1S/C23H40OS/c1-6-13-20(25)15-12-10-8-7-9-11-14-19-17-21(23(3,4)5)22(24)16-18(19)2/h16-17,20,24-25H,6-15H2,1-5H3 |
| InChIKey | NWSRVCYFVFVYNY-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.64 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|