C32H42N2O7 — CID 139773005
3-N,4-N-dihexyl-2,5-bis(4-hydroxy-3-methoxyphenyl)furan-3,4-dicarboxamide (PubChem CID 139773005) has the molecular formula C32H42N2O7 and a molecular weight of 566.70 g/mol. Its IUPAC name is 3-N,4-N-dihexyl-2,5-bis(4-hydroxy-3-methoxyphenyl)furan-3,4-dicarboxamide.
| Compound Name | 3-N,4-N-dihexyl-2,5-bis(4-hydroxy-3-methoxyphenyl)furan-3,4-dicarboxamide |
|---|---|
| PubChem CID | 139773005 |
| Molecular Formula | C32H42N2O7 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 3-N,4-N-dihexyl-2,5-bis(4-hydroxy-3-methoxyphenyl)furan-3,4-dicarboxamide |
| SMILES | CCCCCCNC(=O)c1c(-c2ccc(O)c(OC)c2)oc(-c2ccc(O)c(OC)c2)c1C(=O)NCCCCCC |
| InChI | InChI=1S/C32H42N2O7/c1-5-7-9-11-17-33-31(37)27-28(32(38)34-18-12-10-8-6-2)30(22-14-16-24(36)26(20-22)40-4)41-29(27)21-13-15-23(35)25(19-21)39-3/h13-16,19-20,35-36H,5-12,17-18H2,1-4H3,(H,33,37)(H,34,38) |
| InChIKey | CGHSRGAGEBXBEY-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|