C8H9Cl2NS — CID 139776779
2-amino-5-(1,2-dichloroethyl)benzenethiol (PubChem CID 139776779) has the molecular formula C8H9Cl2NS and a molecular weight of 222.14 g/mol. Its IUPAC name is 2-amino-5-(1,2-dichloroethyl)benzenethiol.
| Compound Name | 2-amino-5-(1,2-dichloroethyl)benzenethiol |
|---|---|
| PubChem CID | 139776779 |
| Molecular Formula | C8H9Cl2NS |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 2-amino-5-(1,2-dichloroethyl)benzenethiol |
| SMILES | Nc1ccc(C(Cl)CCl)cc1S |
| InChI | InChI=1S/C8H9Cl2NS/c9-4-6(10)5-1-2-7(11)8(12)3-5/h1-3,6,12H,4,11H2 |
| InChIKey | RWLWYJBXNOUNRY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|