C29H23N3O6 — CID 139779669
4-[(4-nitrophenyl)methyl]-3-oxo-N-(4-phenylmethoxyphenyl)-1,4-benzoxazine-7-carboxamide (PubChem CID 139779669) has the molecular formula C29H23N3O6 and a molecular weight of 509.52 g/mol. Its IUPAC name is 4-[(4-nitrophenyl)methyl]-3-oxo-N-(4-phenylmethoxyphenyl)-1,4-benzoxazine-7-carboxamide.
| Compound Name | 4-[(4-nitrophenyl)methyl]-3-oxo-N-(4-phenylmethoxyphenyl)-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 139779669 |
| Molecular Formula | C29H23N3O6 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 4-[(4-nitrophenyl)methyl]-3-oxo-N-(4-phenylmethoxyphenyl)-1,4-benzoxazine-7-carboxamide |
| SMILES | O=C(Nc1ccc(OCc2ccccc2)cc1)c1ccc2c(c1)OCC(=O)N2Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H23N3O6/c33-28-19-38-27-16-22(8-15-26(27)31(28)17-20-6-11-24(12-7-20)32(35)36)29(34)30-23-9-13-25(14-10-23)37-18-21-4-2-1-3-5-21/h1-16H,17-19H2,(H,30,34) |
| InChIKey | YSFWNNMCFJZFRM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|