C20H16N2O3S — CID 3231761
N-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)thiophene-2-carboxamide (PubChem CID 3231761) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)thiophene-2-carboxamide.
| Compound Name | N-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3231761 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCC(=O)N2Cc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H16N2O3S/c23-19-13-25-17-11-15(21-20(24)18-7-4-10-26-18)8-9-16(17)22(19)12-14-5-2-1-3-6-14/h1-11H,12-13H2,(H,21,24) |
| InChIKey | MLPHHGQIAWCLGI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |