C28H29N3O3 — CID 156827900
1-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)-3-(4-phenylcyclohexyl)urea (PubChem CID 156827900) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)-3-(4-phenylcyclohexyl)urea.
| Compound Name | 1-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)-3-(4-phenylcyclohexyl)urea |
|---|---|
| PubChem CID | 156827900 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 1-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)-3-(4-phenylcyclohexyl)urea |
| SMILES | O=C(Nc1ccc2c(c1)OCC(=O)N2Cc1ccccc1)NC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C28H29N3O3/c32-27-19-34-26-17-24(15-16-25(26)31(27)18-20-7-3-1-4-8-20)30-28(33)29-23-13-11-22(12-14-23)21-9-5-2-6-10-21/h1-10,15-17,22-23H,11-14,18-19H2,(H2,29,30,33) |
| InChIKey | YVCZGZIBWWTCMU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |