C24H20N4O3 — CID 156828159
1-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)-3-(1H-indol-6-yl)urea (PubChem CID 156828159) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)-3-(1H-indol-6-yl)urea.
| Compound Name | 1-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)-3-(1H-indol-6-yl)urea |
|---|---|
| PubChem CID | 156828159 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-(4-benzyl-3-oxo-1,4-benzoxazin-7-yl)-3-(1H-indol-6-yl)urea |
| SMILES | O=C(Nc1ccc2c(c1)OCC(=O)N2Cc1ccccc1)Nc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C24H20N4O3/c29-23-15-31-22-13-19(8-9-21(22)28(23)14-16-4-2-1-3-5-16)27-24(30)26-18-7-6-17-10-11-25-20(17)12-18/h1-13,25H,14-15H2,(H2,26,27,30) |
| InChIKey | XVHDZEQJDVYNJD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |