C22H18N6O3 — CID 156827981
1-(1H-indol-6-yl)-3-[3-oxo-4-(pyrazin-2-ylmethyl)-1,4-benzoxazin-7-yl]urea (PubChem CID 156827981) has the molecular formula C22H18N6O3 and a molecular weight of 414.43 g/mol. Its IUPAC name is 1-(1H-indol-6-yl)-3-[3-oxo-4-(pyrazin-2-ylmethyl)-1,4-benzoxazin-7-yl]urea.
| Compound Name | 1-(1H-indol-6-yl)-3-[3-oxo-4-(pyrazin-2-ylmethyl)-1,4-benzoxazin-7-yl]urea |
|---|---|
| PubChem CID | 156827981 |
| Molecular Formula | C22H18N6O3 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-(1H-indol-6-yl)-3-[3-oxo-4-(pyrazin-2-ylmethyl)-1,4-benzoxazin-7-yl]urea |
| SMILES | O=C(Nc1ccc2c(c1)OCC(=O)N2Cc1cnccn1)Nc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C22H18N6O3/c29-21-13-31-20-10-16(3-4-19(20)28(21)12-17-11-23-7-8-24-17)27-22(30)26-15-2-1-14-5-6-25-18(14)9-15/h1-11,25H,12-13H2,(H2,26,27,30) |
| InChIKey | QZGQXVOXRCVGCC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |