C10H7Cl2F3N2 — CID 139780205
2-(2,4,5-trifluorophenyl)pyrimidine;dihydrochloride (PubChem CID 139780205) has the molecular formula C10H7Cl2F3N2 and a molecular weight of 283.08 g/mol. Its IUPAC name is 2-(2,4,5-trifluorophenyl)pyrimidine;dihydrochloride.
| Compound Name | 2-(2,4,5-trifluorophenyl)pyrimidine;dihydrochloride |
|---|---|
| PubChem CID | 139780205 |
| Molecular Formula | C10H7Cl2F3N2 |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 2-(2,4,5-trifluorophenyl)pyrimidine;dihydrochloride |
| SMILES | Cl.Cl.Fc1cc(F)c(-c2ncccn2)cc1F |
| InChI | InChI=1S/C10H5F3N2.2ClH/c11-7-5-9(13)8(12)4-6(7)10-14-2-1-3-15-10;;/h1-5H;2*1H |
| InChIKey | MPOCVKFSSUEGED-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|