C27H23N7O3S3 — CID 139780373
O-benzhydryl (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1H-1,2,4-triazol-5-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate (PubChem CID 139780373) has the molecular formula C27H23N7O3S3 and a molecular weight of 589.73 g/mol. Its IUPAC name is O-benzhydryl (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1H-1,2,4-triazol-5-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate.
| Compound Name | O-benzhydryl (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1H-1,2,4-triazol-5-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 139780373 |
| Molecular Formula | C27H23N7O3S3 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | O-benzhydryl (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1H-1,2,4-triazol-5-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
| SMILES | Nc1nc(CC(=O)N[C@@H]2C(=O)N3C(C(=S)OC(c4ccccc4)c4ccccc4)=C(c4ncn[nH]4)CS[C@H]23)cs1 |
| InChI | InChI=1S/C27H23N7O3S3/c28-27-31-17(12-40-27)11-19(35)32-20-24(36)34-21(18(13-39-25(20)34)23-29-14-30-33-23)26(38)37-22(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,12,14,20,22,25H,11,13H2,(H2,28,31)(H,32,35)(H,29,30,33)/t20-,25-/m1/s1 |
| InChIKey | ZAUSBHNZCUUTMH-CJFMBICVSA-N |
| XLogP | 3.33 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|