C29H23N5O4S4 — CID 139780282
O-benzhydryl (6R,7R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1,3-thiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate (PubChem CID 139780282) has the molecular formula C29H23N5O4S4 and a molecular weight of 633.80 g/mol. Its IUPAC name is O-benzhydryl (6R,7R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1,3-thiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate.
| Compound Name | O-benzhydryl (6R,7R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1,3-thiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 139780282 |
| Molecular Formula | C29H23N5O4S4 |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.06 |
| IUPAC Name | O-benzhydryl (6R,7R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(1,3-thiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
| SMILES | O=CNc1nc(CC(=O)N[C@@H]2C(=O)N3C(C(=S)OC(c4ccccc4)c4ccccc4)=C(c4nccs4)CS[C@H]23)cs1 |
| InChI | InChI=1S/C29H23N5O4S4/c35-16-31-29-32-19(14-42-29)13-21(36)33-22-26(37)34-23(20(15-41-27(22)34)25-30-11-12-40-25)28(39)38-24(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-12,14,16,22,24,27H,13,15H2,(H,33,36)(H,31,32,35)/t22-,27-/m1/s1 |
| InChIKey | YCFQFBBOIALRIB-AJTFRIOCSA-N |
| XLogP | 4.66 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|