C29H24N6O4S4 — CID 139780387
O-benzhydryl (6R,7R)-7-[[2-(2-formamido-4-methyl-1,3-thiazol-5-yl)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate (PubChem CID 139780387) has the molecular formula C29H24N6O4S4 and a molecular weight of 648.82 g/mol. Its IUPAC name is O-benzhydryl (6R,7R)-7-[[2-(2-formamido-4-methyl-1,3-thiazol-5-yl)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate.
| Compound Name | O-benzhydryl (6R,7R)-7-[[2-(2-formamido-4-methyl-1,3-thiazol-5-yl)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 139780387 |
| Molecular Formula | C29H24N6O4S4 |
| Molecular Weight | 648.82 g/mol |
| Exact Mass | 648.07 |
| IUPAC Name | O-benzhydryl (6R,7R)-7-[[2-(2-formamido-4-methyl-1,3-thiazol-5-yl)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
| SMILES | Cc1nc(NC=O)sc1CC(=O)N[C@@H]1C(=O)N2C(C(=S)OC(c3ccccc3)c3ccccc3)=C(c3nncs3)CS[C@H]12 |
| InChI | InChI=1S/C29H24N6O4S4/c1-16-20(43-29(32-16)30-14-36)12-21(37)33-22-26(38)35-23(19(13-41-27(22)35)25-34-31-15-42-25)28(40)39-24(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,14-15,22,24,27H,12-13H2,1H3,(H,33,37)(H,30,32,36)/t22-,27-/m1/s1 |
| InChIKey | NCRHRSRUWREMTJ-AJTFRIOCSA-N |
| XLogP | 4.36 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|