C28H21N3O3S3 — CID 139780232
O-benzhydryl (6R,7R)-3-(1,3-benzothiazol-2-yl)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate (PubChem CID 139780232) has the molecular formula C28H21N3O3S3 and a molecular weight of 543.70 g/mol. Its IUPAC name is O-benzhydryl (6R,7R)-3-(1,3-benzothiazol-2-yl)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate.
| Compound Name | O-benzhydryl (6R,7R)-3-(1,3-benzothiazol-2-yl)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 139780232 |
| Molecular Formula | C28H21N3O3S3 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | O-benzhydryl (6R,7R)-3-(1,3-benzothiazol-2-yl)-7-formamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
| SMILES | O=CN[C@@H]1C(=O)N2C(C(=S)OC(c3ccccc3)c3ccccc3)=C(c3nc4ccccc4s3)CS[C@H]12 |
| InChI | InChI=1S/C28H21N3O3S3/c32-16-29-22-26(33)31-23(19(15-36-27(22)31)25-30-20-13-7-8-14-21(20)37-25)28(35)34-24(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14,16,22,24,27H,15H2,(H,29,32)/t22-,27-/m1/s1 |
| InChIKey | APKAFKDQTNNEBT-AJTFRIOCSA-N |
| XLogP | 5.17 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|