C32H30N4O2 — CID 139781766
2,7-bis(4-pyrrolidin-1-ylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione (PubChem CID 139781766) has the molecular formula C32H30N4O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 2,7-bis(4-pyrrolidin-1-ylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione.
| Compound Name | 2,7-bis(4-pyrrolidin-1-ylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
|---|---|
| PubChem CID | 139781766 |
| Molecular Formula | C32H30N4O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 2,7-bis(4-pyrrolidin-1-ylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
| SMILES | O=c1cc(-c2ccc(N3CCCC3)cc2)[nH]c2cc3c(=O)cc(-c4ccc(N5CCCC5)cc4)[nH]c3cc12 |
| InChI | InChI=1S/C32H30N4O2/c37-31-19-27(21-5-9-23(10-6-21)35-13-1-2-14-35)33-29-17-26-30(18-25(29)31)34-28(20-32(26)38)22-7-11-24(12-8-22)36-15-3-4-16-36/h5-12,17-20H,1-4,13-16H2,(H,33,37)(H,34,38) |
| InChIKey | YCDUWGROUKWHBP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|