C33H31N2O7P — CID 142713834
[3-(4-oxo-6-pyrrolidin-1-yl-1H-quinolin-2-yl)phenyl] bis(phenylmethoxy) phosphate (PubChem CID 142713834) has the molecular formula C33H31N2O7P and a molecular weight of 598.59 g/mol. Its IUPAC name is [3-(4-oxo-6-pyrrolidin-1-yl-1H-quinolin-2-yl)phenyl] bis(phenylmethoxy) phosphate.
| Compound Name | [3-(4-oxo-6-pyrrolidin-1-yl-1H-quinolin-2-yl)phenyl] bis(phenylmethoxy) phosphate |
|---|---|
| PubChem CID | 142713834 |
| Molecular Formula | C33H31N2O7P |
| Molecular Weight | 598.59 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | [3-(4-oxo-6-pyrrolidin-1-yl-1H-quinolin-2-yl)phenyl] bis(phenylmethoxy) phosphate |
| SMILES | O=c1cc(-c2cccc(OP(=O)(OOCc3ccccc3)OOCc3ccccc3)c2)[nH]c2ccc(N3CCCC3)cc12 |
| InChI | InChI=1S/C33H31N2O7P/c36-33-22-32(34-31-17-16-28(21-30(31)33)35-18-7-8-19-35)27-14-9-15-29(20-27)40-43(37,41-38-23-25-10-3-1-4-11-25)42-39-24-26-12-5-2-6-13-26/h1-6,9-17,20-22H,7-8,18-19,23-24H2,(H,34,36) |
| InChIKey | GAZQWNXSSJUNRN-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.59 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|