C47H44N2O8P2 — CID 58052628
dibenzyl [2-[3-bis(phenylmethoxy)phosphoryloxyphenyl]-6-pyrrolidin-1-ylquinolin-4-yl] phosphate (PubChem CID 58052628) has the molecular formula C47H44N2O8P2 and a molecular weight of 826.82 g/mol. Its IUPAC name is dibenzyl [2-[3-bis(phenylmethoxy)phosphoryloxyphenyl]-6-pyrrolidin-1-ylquinolin-4-yl] phosphate.
| Compound Name | dibenzyl [2-[3-bis(phenylmethoxy)phosphoryloxyphenyl]-6-pyrrolidin-1-ylquinolin-4-yl] phosphate |
|---|---|
| PubChem CID | 58052628 |
| Molecular Formula | C47H44N2O8P2 |
| Molecular Weight | 826.82 g/mol |
| Exact Mass | 826.26 |
| IUPAC Name | dibenzyl [2-[3-bis(phenylmethoxy)phosphoryloxyphenyl]-6-pyrrolidin-1-ylquinolin-4-yl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)Oc1cccc(-c2cc(OP(=O)(OCc3ccccc3)OCc3ccccc3)c3cc(N4CCCC4)ccc3n2)c1 |
| InChI | InChI=1S/C47H44N2O8P2/c50-58(52-33-37-16-5-1-6-17-37,53-34-38-18-7-2-8-19-38)56-43-25-15-24-41(30-43)46-32-47(44-31-42(26-27-45(44)48-46)49-28-13-14-29-49)57-59(51,54-35-39-20-9-3-10-21-39)55-36-40-22-11-4-12-23-40/h1-12,15-27,30-32H,13-14,28-29,33-36H2 |
| InChIKey | LKWBOPXHMRFVOE-UHFFFAOYSA-N |
| XLogP | 12.34 |
| TPSA | 105.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.82 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|