C31H26NO7P — CID 59392953
dibenzyl [6-(3-methoxyphenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate (PubChem CID 59392953) has the molecular formula C31H26NO7P and a molecular weight of 555.52 g/mol. Its IUPAC name is dibenzyl [6-(3-methoxyphenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate.
| Compound Name | dibenzyl [6-(3-methoxyphenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate |
|---|---|
| PubChem CID | 59392953 |
| Molecular Formula | C31H26NO7P |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | dibenzyl [6-(3-methoxyphenyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl] phosphate |
| SMILES | COc1cccc(-c2cc(OP(=O)(OCc3ccccc3)OCc3ccccc3)c3cc4c(cc3n2)OCO4)c1 |
| InChI | InChI=1S/C31H26NO7P/c1-34-25-14-8-13-24(15-25)27-17-29(26-16-30-31(36-21-35-30)18-28(26)32-27)39-40(33,37-19-22-9-4-2-5-10-22)38-20-23-11-6-3-7-12-23/h2-18H,19-21H2,1H3 |
| InChIKey | MKZCAVPZZBGQFV-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 85.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|