C25H20N2O4 — CID 53113418
N-(4-ethoxy-2-phenylquinolin-6-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 53113418) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-(4-ethoxy-2-phenylquinolin-6-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(4-ethoxy-2-phenylquinolin-6-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 53113418 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-(4-ethoxy-2-phenylquinolin-6-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CCOc1cc(-c2ccccc2)nc2ccc(NC(=O)c3ccc4c(c3)OCO4)cc12 |
| InChI | InChI=1S/C25H20N2O4/c1-2-29-23-14-21(16-6-4-3-5-7-16)27-20-10-9-18(13-19(20)23)26-25(28)17-8-11-22-24(12-17)31-15-30-22/h3-14H,2,15H2,1H3,(H,26,28) |
| InChIKey | LWBKFDMFTGLFEK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |